Vedaprofen
Catalog No: FT-0675791
CAS No: 71109-09-6
- Chemical Name: Vedaprofen
- Molecular Formula: C19H22O2
- Molecular Weight: 282.4
- InChI Key: VZUGVMQFWFVFBX-UHFFFAOYSA-N
- InChI: InChI=1S/C19H22O2/c1-13(19(20)21)15-11-12-16(14-7-3-2-4-8-14)18-10-6-5-9-17(15)18/h5-6,9-14H,2-4,7-8H2,1H3,(H,20,21)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 71109-09-6 |
| Flash_Point: | 362.5ºC |
| Product_Name: | vedaprofen |
| Bolling_Point: | 465.9ºC at 760 mmHg |
| FW: | 282.37700 |
| Melting_Point: | 150ºC |
| MF: | C19H22O2 |
| Density: | 1.132g/cm3 |
| Melting_Point: | 150ºC |
|---|---|
| Refractive_Index: | 1.603 |
| MF: | C19H22O2 |
| Flash_Point: | 362.5ºC |
| LogP: | 5.07560 |
| FW: | 282.37700 |
| Density: | 1.132g/cm3 |
| PSA: | 37.30000 |
| Bolling_Point: | 465.9ºC at 760 mmHg |
| Exact_Mass: | 282.16200 |
| Symbol: | GHS07 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P301 + P312 + P330 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)