4-Methylumbelliferyl a-L-Arabinosfuranoside
Catalog No: FT-0672323
CAS No: 77471-44-4
- Chemical Name: 4-Methylumbelliferyl a-L-Arabinosfuranoside
- Molecular Formula: C15H16O7
- Molecular Weight: 308.28
- InChI Key: FAGLTVBWEMHJRP-SPWCGHHHSA-N
- InChI: InChI=1S/C15H16O7/c1-7-4-12(17)21-10-5-8(2-3-9(7)10)20-15-14(19)13(18)11(6-16)22-15/h2-5,11,13-16,18-19H,6H2,1H3/t11-,13-,14+,15+/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 308.28300 |
| Density: | 1.486g/cm3 |
| CAS: | 77471-44-4 |
| Bolling_Point: | 599.4ºC at 760 mmHg |
| Product_Name: | 4-Methylumbelliferyl α-L-Arabinosfuranoside |
| Melting_Point: | N/A |
| Flash_Point: | 228.1ºC |
| MF: | C15H16O7 |
| Density: | 1.486g/cm3 |
|---|---|
| Flash_Point: | 228.1ºC |
| Refractive_Index: | 1.631 |
| FW: | 308.28300 |
| PSA: | 109.36000 |
| MF: | C15H16O7 |
| Bolling_Point: | 599.4ºC at 760 mmHg |
| Exact_Mass: | 308.09000 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P2 (EN 143) respirator cartridges;type P3 (EN 143) respirator cartridges |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R20/22 |
| Safety_Statements: | 7-24-45 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P301 + P312 + P330-P308 + P311 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)