4-Methylbenzotriazole
Catalog No: FT-0671521
CAS No: 29878-31-7
- Chemical Name: 4-Methylbenzotriazole
- Molecular Formula: C7H7N3
- Molecular Weight: 133.15
- InChI Key: CMGDVUCDZOBDNL-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7N3/c1-5-3-2-4-6-7(5)9-10-8-6/h2-4H,1H3,(H,8,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 29878-31-7 |
| Flash_Point: | 137.4ºC |
| Product_Name: | 4-methyl-2H-benzotriazole |
| Bolling_Point: | 289.3ºC at 760 mmHg |
| FW: | 133.15100 |
| Melting_Point: | N/A |
| MF: | C7H7N3 |
| Density: | 1.273 g/cm3 |
| MF: | C7H7N3 |
|---|---|
| Flash_Point: | 137.4ºC |
| LogP: | 1.26630 |
| FW: | 133.15100 |
| Density: | 1.273 g/cm3 |
| PSA: | 41.57000 |
| Bolling_Point: | 289.3ºC at 760 mmHg |
| Exact_Mass: | 133.06400 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P273-P305 + P351 + P338 |
| Safety_Statements: | H302 + H332-H319-H412 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)