![4-Methoxy-[7-13C]-benzoic Acid (CAS: 69838-89-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0671155.webp "4-Methoxy-[7-13C]-benzoic Acid chemical structure")
4-Methoxy-[7-13C]-benzoic Acid
Catalog No: FT-0671155
CAS No: 69838-89-7
- Chemical Name: 4-Methoxy-[7-13C]-benzoic Acid
- Molecular Formula: C8H8O3
- Molecular Weight: 153.14 g/mol
- InChI Key: ZEYHEAKUIGZSGI-VJJZLTLGSA-N
- InChI: InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10)/i8+1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 153.14000 |
| Density: | N/A |
| CAS: | 69838-89-7 |
| Bolling_Point: | N/A |
| Product_Name: | 4-methoxybenzoic acid |
| Melting_Point: | 182-185ºC |
| Flash_Point: | 185 °C |
| MF: | C8H8O3 |
| LogP: | 1.39340 |
|---|---|
| Melting_Point: | 182-185ºC |
| FW: | 153.14000 |
| PSA: | 46.53000 |
| MF: | C8H8O3 |
| Exact_Mass: | 153.05100 |
| Flash_Point_(C): | 185 °C |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| Flash_Point_(F): | 365 °F |
| RIDADR: | NONH for all modes of transport |
