L-Methionine-S-methyl Sulfonium Chloride
Catalog No: FT-0671135
CAS No: 1115-84-0
- Chemical Name: L-Methionine-S-methyl Sulfonium Chloride
- Molecular Formula: C6H14NO2S.Cl
- Molecular Weight: 199.70
- InChI Key: MYGVPKMVGSXPCQ-JEDNCBNOSA-N
- InChI: InChI=1S/C6H13NO2S.ClH/c1-10(2)4-3-5(7)6(8)9;/h5H,3-4,7H2,1-2H3;1H/t5-;/m0./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | L-Methionine-S-methyl Sulfonium Chloride |
|---|---|
| Flash_Point: | N/A |
| Melting_Point: | 134ºC |
| FW: | 199.69900 |
| Density: | N/A |
| CAS: | 1115-84-0 |
| Bolling_Point: | N/A |
| MF: | C6H14ClNO2S |
| LogP: | 1.16860 |
|---|---|
| Melting_Point: | 134ºC |
| FW: | 199.69900 |
| PSA: | 88.62000 |
| MF: | C6H14ClNO2S |
| Exact_Mass: | 199.04300 |
| Hazard_Codes: | Xn,N,T,F |
|---|---|
| RTECS: | CZ0175000 |
| Risk_Statements(EU): | R10:Flammable. R20:Harmful by inhalation. R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment . R40:Limited evidence of a carcinogenic effect. R39/23/24/25:Toxic: danger of very serious irreversible effects thr |
| Packing_Group: | III |
| Hazard_Class: | 3 |
| RIDADR: | UN 1134 3/PG 3 |
| HS_Code: | 2930909090 |
| WGK_Germany: | 2 |
| Safety_Statements: | S24/25-S61-S36/37-S45 |
Related Products
Methyl 2,3,4-Triacetyl-D-glucopyranosiduronyl 1-(N-4-Methoxyphenyl)-2,2,2-trifluoroacetimidate
N-(Methanethiosulfonylethylcarboxamidoethyl)-5 -naphthylamine-1-sulfonic acid, Sodium Salt
