Methedrone Hydrochloride
Catalog No: FT-0671131
CAS No: 879665-92-6
- Chemical Name: Methedrone Hydrochloride
- Molecular Formula: C11H16ClNO2
- Molecular Weight: 229.70
- InChI Key: QIJFAKGYWIXUDG-UHFFFAOYSA-N
- InChI: InChI=1S/C11H15NO2.ClH/c1-8(12-2)11(13)9-4-6-10(14-3)7-5-9;/h4-8,12H,1-3H3;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 193.242 |
| Density: | 1.0±0.1 g/cm3 |
| CAS: | 879665-92-6 |
| Bolling_Point: | 313.7±22.0 °C at 760 mmHg |
| Product_Name: | methoxyphedrine |
| Melting_Point: | N/A |
| Flash_Point: | 143.5±22.3 °C |
| MF: | C11H15NO2 |
| Density: | 1.0±0.1 g/cm3 |
|---|---|
| LogP: | 1.47 |
| Flash_Point: | 143.5±22.3 °C |
| Refractive_Index: | 1.508 |
| FW: | 193.242 |
| PSA: | 38.33000 |
| MF: | C11H15NO2 |
| Bolling_Point: | 313.7±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 193.110275 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H317-H319-H335 |
| Symbol: | Warning |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)