(R)-Limonene 1,2-epoxide (Mixture of Diastereomers)
Catalog No: FT-0670792
CAS No: 203719-54-4
- Chemical Name: (R)-Limonene 1,2-epoxide (Mixture of Diastereomers)
- Molecular Formula: C10H16O
- Molecular Weight: 152.23
- InChI Key: CCEFMUBVSUDRLG-XNWIYYODSA-N
- InChI: InChI=1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9?,10?/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Limonene Oxide |
|---|---|
| Flash_Point: | 65.6±0.0 °C |
| Melting_Point: | N/A |
| FW: | 152.233 |
| Density: | 1.0±0.1 g/cm3 |
| CAS: | 203719-54-4 |
| Bolling_Point: | 198.1±9.0 °C at 760 mmHg |
| MF: | C10H18O |
| Density: | 1.0±0.1 g/cm3 |
|---|---|
| LogP: | 2.43 |
| Flash_Point: | 65.6±0.0 °C |
| Refractive_Index: | 1.491 |
| FW: | 152.233 |
| PSA: | 12.53000 |
| MF: | C10H18O |
| Bolling_Point: | 198.1±9.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.5±0.4 mmHg at 25°C |
| Exact_Mass: | 152.120117 |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| HS_Code: | 2932999099 |
| WGK_Germany: | 3 |
| Safety_Statements: | 23-24/25 |
Related Products
2,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
1-[3-[[(2R,3S,4R,5R)-5-(4-amino-5-bromopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea