Fumaric Acid Monomethyl Ester
Catalog No: FT-0668592
CAS No: 2756-87-8
- Chemical Name: Fumaric Acid Monomethyl Ester
- Molecular Formula: C5H6O4
- Molecular Weight: 130.1
- InChI Key: NKHAVTQWNUWKEO-UHFFFAOYSA-N
- InChI: InChI=1S/C5H6O4/c1-9-5(8)3-2-4(6)7/h2-3H,1H3,(H,6,7)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-Methoxy-4-oxobut-2-enoic acid |
|---|---|
| Bolling_Point: | 250.0±23.0 °C at 760 mmHg |
| MF: | C5H6O4 |
| Symbol: | GHS05 |
| Melting_Point: | 144-145ºC |
| CAS: | 2756-87-8 |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 130.099 |
| Flash_Point: | 108.9±16.1 °C |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
|---|---|
| Exact_Mass: | 130.026611 |
| Refractive_Index: | 1.469 |
| LogP: | -0.24 |
| Bolling_Point: | 250.0±23.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| MF: | C5H6O4 |
| PSA: | 63.60000 |
| FW: | 130.099 |
| Flash_Point: | 108.9±16.1 °C |
| Melting_Point: | 144-145ºC |
| Risk_Statements(EU): | R41 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Safety_Statements: | H318 |
| HS_Code: | 2918990090 |
| WGK_Germany: | 3 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS05 |
| Hazard_Codes: | Xi:Irritant; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)