![(2S)-2-Ethyl-8-methyl-1-thia-4,8-diazaspiro[4,5]decan-3-one (CAS: 503431-81-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0668336.png "(2S)-2-Ethyl-8-methyl-1-thia-4,8-diazaspiro[4,5]decan-3-one chemical structure")
(2S)-2-Ethyl-8-methyl-1-thia-4,8-diazaspiro[4,5]decan-3-one
Catalog No: FT-0668336
CAS No: 503431-81-0
- Chemical Name: (2S)-2-Ethyl-8-methyl-1-thia-4,8-diazaspiro[4,5]decan-3-one
- Molecular Formula: C10H18N2OS
- Molecular Weight: 214.33
- InChI Key: PHOZOHFUXHPOCK-QMMMGPOBSA-N
- InChI: InChI=1S/C10H18N2OS/c1-3-8-9(13)11-10(14-8)4-6-12(2)7-5-10/h8H,3-7H2,1-2H3,(H,11,13)/t8-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (2S)-2-ethyl-8-methyl-1-thia-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| Flash_Point: | 195.21ºC |
| Melting_Point: | 132-134ºC |
| FW: | 214.32800 |
| Density: | 1.171g/cm3 |
| CAS: | 503431-81-0 |
| Bolling_Point: | 399.167ºC at 760 mmHg |
| MF: | C10H18N2OS |
| Density: | 1.171g/cm3 |
|---|---|
| LogP: | 1.31660 |
| Flash_Point: | 195.21ºC |
| Melting_Point: | 132-134ºC |
| FW: | 214.32800 |
| PSA: | 57.64000 |
| Exact_Mass: | 214.11400 |
| MF: | C10H18N2OS |
| Bolling_Point: | 399.167ºC at 760 mmHg |
| Refractive_Index: | 1.569 |
| HS_Code: | 2934999090 |
|---|
Related Products
(Z)-4-Hydroxy-N-desmethyl Tamoxifen (contains up to 10% E isomer)
2-(1-Hydroxypentyl)-6-methyl-3-(2-phenylethyl)-1H-indole-5-carboxylic Acid
