rac-5-Ethyl-(5-Hydroxyphenyl)hydantoin
Catalog No: FT-0668294
CAS No: 61837-66-9
- Chemical Name: rac-5-Ethyl-(5-Hydroxyphenyl)hydantoin
- Molecular Formula: C11H12N2O3
- Molecular Weight: 220.22
- InChI Key: LZFIVJCLUUNXKT-UHFFFAOYSA-N
- InChI: InChI=1S/C11H12N2O3/c1-2-11(9(15)12-10(16)13-11)7-3-5-8(14)6-4-7/h3-6,14H,2H2,1H3,(H2,12,13,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 61837-66-9 |
| Flash_Point: | N/A |
| Product_Name: | 5-(4’-Hydroxyphenyl)-5-ethylhydantion |
| Bolling_Point: | N/A |
| FW: | 220.22500 |
| Melting_Point: | 260ºC |
| MF: | C11H12N2O3 |
| Density: | 1.277g/cm3 |
| Melting_Point: | 260ºC |
|---|---|
| Refractive_Index: | 1.567 |
| MF: | C11H12N2O3 |
| Exact_Mass: | 220.08500 |
| LogP: | 1.49450 |
| FW: | 220.22500 |
| Density: | 1.277g/cm3 |
| PSA: | 78.43000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933990090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RTECS: | NI9453716 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)