Dinotefuran
Catalog No: FT-0667610
CAS No: 165252-70-0
- Chemical Name: Dinotefuran
- Molecular Formula: C7H14N4O3
- Molecular Weight: 202.21
- InChI Key: YKBZOVFACRVRJN-UHFFFAOYSA-N
- InChI: InChI=1S/C7H14N4O3/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6/h6H,2-5H2,1H3,(H2,8,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 202.211 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 165252-70-0 |
| Bolling_Point: | 334.5±34.0 °C at 760 mmHg |
| Product_Name: | Dinotefuran |
| Melting_Point: | 107.5ºC |
| Flash_Point: | 156.1±25.7 °C |
| MF: | C7H14N4O3 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | -0.70 |
| Flash_Point: | 156.1±25.7 °C |
| Melting_Point: | 107.5ºC |
| FW: | 202.211 |
| PSA: | 91.47000 |
| Exact_Mass: | 202.106583 |
| MF: | C7H14N4O3 |
| Bolling_Point: | 334.5±34.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Refractive_Index: | 1.596 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2934100016 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)