Decanoic Acid-1,2-13C2
Catalog No: FT-0665533
CAS No: 287111-30-2
- Chemical Name: Decanoic Acid-1,2-13C2
- Molecular Formula: C10H20O2
- Molecular Weight: 174.25
- InChI Key: GHVNFZFCNZKVNT-OJJJIBSVSA-N
- InChI: InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/i9+1,10+1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 174.25000 |
| Density: | N/A |
| CAS: | 287111-30-2 |
| Bolling_Point: | N/A |
| Product_Name: | decanoic acid |
| Melting_Point: | N/A |
| Flash_Point: | 110 °C |
| MF: | C10H20O2 |
| LogP: | 3.21170 |
|---|---|
| PSA: | 37.30000 |
| MF: | C10H20O2 |
| FW: | 174.25000 |
| Exact_Mass: | 174.15300 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Flash_Point_(C): | 110 °C |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| Flash_Point_(F): | 230 °F |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)