2-Chloro-5-nitro-N-4-pyridinylbenzamide
Catalog No: FT-0664847
CAS No: 313516-66-4
- Chemical Name: 2-Chloro-5-nitro-N-4-pyridinylbenzamide
- Molecular Formula: C12H8ClN3O3
- Molecular Weight: 277.66
- InChI Key: FRPJSHKMZHWJBE-UHFFFAOYSA-N
- InChI: InChI=1S/C12H8ClN3O3/c13-11-2-1-9(16(18)19)7-10(11)12(17)15-8-3-5-14-6-4-8/h1-7H,(H,14,15,17)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 277.663 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 313516-66-4 |
| Bolling_Point: | 381.7±37.0 °C at 760 mmHg |
| Product_Name: | T0070907 |
| Melting_Point: | N/A |
| Flash_Point: | 184.6±26.5 °C |
| MF: | C12H8ClN3O3 |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 2.25 |
| Flash_Point: | 184.6±26.5 °C |
| Refractive_Index: | 1.684 |
| FW: | 277.663 |
| PSA: | 87.81000 |
| MF: | C12H8ClN3O3 |
| Bolling_Point: | 381.7±37.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Exact_Mass: | 277.025421 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)