![5-Bromobenzo[b]furan-2-carbaldehyde (CAS: 23145-16-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0663644.png "5-Bromobenzo[b]furan-2-carbaldehyde chemical structure")
5-Bromobenzo[b]furan-2-carbaldehyde
Catalog No: FT-0663644
CAS No: 23145-16-6
- Chemical Name: 5-Bromobenzo[b]furan-2-carbaldehyde
- Molecular Formula: C9H5BrO2
- Molecular Weight: 225.04
- InChI Key: UPEGFMDITWHVHV-UHFFFAOYSA-N
- InChI: InChI=1S/C9H5BrO2/c10-7-1-2-9-6(3-7)4-8(5-11)12-9/h1-5H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 5-Bromo-1-benzofuran-2-carbaldehyde |
|---|---|
| Flash_Point: | 142.8±22.3 °C |
| Melting_Point: | 129ºC |
| FW: | 225.039 |
| Density: | 1.7±0.1 g/cm3 |
| CAS: | 23145-16-6 |
| Bolling_Point: | 312.4±22.0 °C at 760 mmHg |
| MF: | C9H5BrO2 |
| LogP: | 2.49 |
|---|---|
| Flash_Point: | 142.8±22.3 °C |
| Refractive_Index: | 1.682 |
| FW: | 225.039 |
| Bolling_Point: | 312.4±22.0 °C at 760 mmHg |
| Density: | 1.7±0.1 g/cm3 |
| Melting_Point: | 129ºC |
| PSA: | 30.21000 |
| Exact_Mass: | 223.947281 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C9H5BrO2 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2932999099 |
| Safety_Statements: | 22-26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)