![5,7-Dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxine (CAS: 174508-31-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0660060.png "5,7-Dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxine chemical structure")
5,7-Dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxine
Catalog No: FT-0660060
CAS No: 174508-31-7
- Chemical Name: 5,7-Dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxine
- Molecular Formula: C6H4Br2O2S
- Molecular Weight: 299.97
- InChI Key: FHMRWRBNAIDRAP-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4Br2O2S/c7-5-3-4(6(8)11-5)10-2-1-9-3/h1-2H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 299.968 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 174508-31-7 |
| Bolling_Point: | 306.5±42.0 °C at 760 mmHg |
| Product_Name: | 5,7-Dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| Melting_Point: | 98ºC |
| Flash_Point: | 139.2±27.9 °C |
| MF: | C6H4Br2O2S |
| Density: | 2.1±0.1 g/cm3 |
|---|---|
| LogP: | 3.06 |
| Flash_Point: | 139.2±27.9 °C |
| Melting_Point: | 98ºC |
| FW: | 299.968 |
| PSA: | 46.70000 |
| Exact_Mass: | 297.829865 |
| MF: | C6H4Br2O2S |
| Bolling_Point: | 306.5±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.644 |
| Hazard_Codes: | Xn:Harmful |
|---|---|
| Risk_Statements(EU): | R20/21/22;R36/37/38 |
| Safety_Statements: | S22-S26-S36/37/39 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)