2-Amino-4-methyl-3-nitro-pyridine
Catalog No: FT-0659527
CAS No: 6635-86-5
- Chemical Name: 2-Amino-4-methyl-3-nitro-pyridine
- Molecular Formula: C6H7N3O2
- Molecular Weight: 153.14
- InChI Key: IKMZGACFMXZAAT-UHFFFAOYSA-N
- InChI: InChI=1S/C6H7N3O2/c1-4-2-3-8-6(7)5(4)9(10)11/h2-3H,1H3,(H2,7,8)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-Amino-3-nitro-4-picoline |
|---|---|
| Bolling_Point: | 306.8±37.0 °C at 760 mmHg |
| MF: | C6H7N3O2 |
| Symbol: | GHS07 |
| Melting_Point: | 136-140 °C(lit.) |
| CAS: | 6635-86-5 |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 153.139 |
| Flash_Point: | 139.3±26.5 °C |
| MF: | C6H7N3O2 |
|---|---|
| Bolling_Point: | 306.8±37.0 °C at 760 mmHg |
| Exact_Mass: | 153.053833 |
| Melting_Point: | 136-140 °C(lit.) |
| PSA: | 84.73000 |
| Flash_Point: | 139.3±26.5 °C |
| Computational_Chemistry: | ['1. XlogP :12 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :2 ', '6. TPSA 847 ', '7. Heavy Atom Count :11 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :156 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Density: | 1.4±0.1 g/cm3 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| FW: | 153.139 |
| LogP: | 2.08 |
| Refractive_Index: | 1.625 |
| Risk_Statements(EU): | R20/21/22;R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Safety_Statements: | H315-H319-H335 |
| HS_Code: | 29333999 |
| WGK_Germany: | 3 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS07 |
| Hazard_Codes: | Xn:Harmful; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)