Proparacaine hydrochloride
Catalog No: FT-0658833
CAS No: 5875-06-9
- Chemical Name: Proparacaine hydrochloride
- Molecular Formula: C16H27ClN2O3
- Molecular Weight: 330.8
- InChI Key: BFUUJUGQJUTPAF-UHFFFAOYSA-N
- InChI: InChI=1S/C16H26N2O3.ClH/c1-4-10-20-15-8-7-13(12-14(15)17)16(19)21-11-9-18(5-2)6-3;/h7-8,12H,4-6,9-11,17H2,1-3H3;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 5875-06-9 |
| Flash_Point: | 216.5ºC |
| Product_Name: | Proparacaine Hydrochloride |
| Bolling_Point: | 434.4ºC at 760mmHg |
| FW: | 330.850 |
| Melting_Point: | N/A |
| MF: | C16H27ClN2O3 |
| Density: | N/A |
| MF: | C16H27ClN2O3 |
|---|---|
| Flash_Point: | 216.5ºC |
| LogP: | 3.93940 |
| Bolling_Point: | 434.4ºC at 760mmHg |
| FW: | 330.850 |
| PSA: | 64.79000 |
| Exact_Mass: | 330.171021 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R20/21/22;R36;R43 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RTECS: | DG3065000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H312-H317-H319-H332 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)