N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate
Catalog No: FT-0653889
CAS No: 265651-18-1
- Chemical Name: N,N,N',N'-Tetramethyl-O-(N-succinimidyl)uronium hexafluorophosphate
- Molecular Formula: C9H16F6N3O3P
- Molecular Weight: 359.21
- InChI Key: STWZCCVNXFLDDD-UHFFFAOYSA-N
- InChI: InChI=1S/C9H16N3O3.F6P/c1-10(2)9(11(3)4)15-12-7(13)5-6-8(12)14;1-7(2,3,4,5)6/h5-6H2,1-4H3;/q+1;-1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 359.20600 |
| Density: | N/A |
| CAS: | 265651-18-1 |
| Bolling_Point: | N/A |
| Product_Name: | [dimethylamino-(2,5-dioxopyrrolidin-1-yl)oxymethylidene]-dimethylazanium,hexafluorophosphate |
| Melting_Point: | 218-221ºC |
| Flash_Point: | N/A |
| MF: | C9H16F6N3O3P |
| LogP: | 2.57700 |
|---|---|
| Melting_Point: | 218-221ºC |
| FW: | 359.20600 |
| PSA: | 66.45000 |
| MF: | C9H16F6N3O3P |
| Exact_Mass: | 359.08300 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)