2-AMINO-5-CHLORO-6-PICOLINE
Catalog No: FT-0651910
CAS No: 36936-23-9
- Chemical Name: 2-AMINO-5-CHLORO-6-PICOLINE
- Molecular Formula: C6H7ClN2
- Molecular Weight: 142.58
- InChI Key: SHIKRPPKGCWKJO-UHFFFAOYSA-N
- InChI: InChI=1S/C6H7ClN2/c1-4-5(7)2-3-6(8)9-4/h2-3H,1H3,(H2,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 142.586 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 36936-23-9 |
| Bolling_Point: | 234.2±35.0 °C at 760 mmHg |
| Product_Name: | 5-Chloro-6-methyl-2-pyridinamine |
| Melting_Point: | N/A |
| Flash_Point: | 95.4±25.9 °C |
| MF: | C6H7ClN2 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 2.14 |
| Flash_Point: | 95.4±25.9 °C |
| Refractive_Index: | 1.592 |
| FW: | 142.586 |
| PSA: | 38.91000 |
| MF: | C6H7ClN2 |
| Bolling_Point: | 234.2±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.1±0.5 mmHg at 25°C |
| Exact_Mass: | 142.029770 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)