Isoindoline
Catalog No: FT-0651501
CAS No: 496-12-8
- Chemical Name: Isoindoline
- Molecular Formula: C8H9N
- Molecular Weight: 119.16
- InChI Key: GWVMLCQWXVFZCN-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9N/c1-2-4-8-6-9-5-7(8)3-1/h1-4,9H,5-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 119.164 |
| Density: | 1.0±0.1 g/cm3 |
| CAS: | 496-12-8 |
| Bolling_Point: | 199.6±9.0 °C at 760 mmHg |
| Product_Name: | Isoindoline |
| Melting_Point: | 17ºC |
| Flash_Point: | 75.8±14.2 °C |
| MF: | C8H9N |
| LogP: | 1.01 |
|---|---|
| Flash_Point: | 75.8±14.2 °C |
| Refractive_Index: | 1.562 |
| FW: | 119.164 |
| Bolling_Point: | 199.6±9.0 °C at 760 mmHg |
| Density: | 1.0±0.1 g/cm3 |
| Melting_Point: | 17ºC |
| PSA: | 12.03000 |
| Exact_Mass: | 119.073502 |
| Vapor_Pressure: | 0.3±0.4 mmHg at 25°C |
| MF: | C8H9N |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard_Codes: | Xi:Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)