Methyl-quinolin-6-ylmethyl-amine
Catalog No: FT-0651358
CAS No: 179873-36-0
- Chemical Name: Methyl-quinolin-6-ylmethyl-amine
- Molecular Formula: C11H12N2
- Molecular Weight: 172.23
- InChI Key: IIPNTNDPIZNFRU-UHFFFAOYSA-N
- InChI: InChI=1S/C11H12N2/c1-12-8-9-4-5-11-10(7-9)3-2-6-13-11/h2-7,12H,8H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 172.22600 |
| Density: | 1.087g/cm3 |
| CAS: | 179873-36-0 |
| Bolling_Point: | 297.9ºC at 760mmHg |
| Product_Name: | N-Methyl-N-(quinolin-6-ylmethyl)amine |
| Melting_Point: | N/A |
| Flash_Point: | 134ºC |
| MF: | C11H12N2 |
| Density: | 1.087g/cm3 |
|---|---|
| LogP: | 2.34510 |
| Flash_Point: | 134ºC |
| Refractive_Index: | 1.615 |
| FW: | 172.22600 |
| PSA: | 24.92000 |
| MF: | C11H12N2 |
| Bolling_Point: | 297.9ºC at 760mmHg |
| Vapor_Pressure: | 0.00131mmHg at 25°C |
| Exact_Mass: | 172.10000 |
| Hazard_Codes: | C: Corrosive; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)