6-Amino-2-methylphenol
Catalog No: FT-0650398
CAS No: 17672-22-9
- Chemical Name: 6-Amino-2-methylphenol
- Molecular Formula: C7H9NO
- Molecular Weight: 123.15
- InChI Key: ALQKEYVDQYGZDN-UHFFFAOYSA-N
- InChI: InChI=1S/C7H9NO/c1-5-3-2-4-6(8)7(5)9/h2-4,9H,8H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 123.152 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 17672-22-9 |
| Bolling_Point: | 232.9±28.0 °C at 760 mmHg |
| Product_Name: | 2-Amino-6-methylphenol |
| Melting_Point: | 86ºC |
| Flash_Point: | 94.7±24.0 °C |
| MF: | C7H9NO |
| LogP: | 0.90 |
|---|---|
| Flash_Point: | 94.7±24.0 °C |
| Refractive_Index: | 1.616 |
| FW: | 123.152 |
| Bolling_Point: | 232.9±28.0 °C at 760 mmHg |
| Density: | 1.2±0.1 g/cm3 |
| Melting_Point: | 86ºC |
| PSA: | 46.25000 |
| Exact_Mass: | 123.068413 |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| MF: | C7H9NO |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922299090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)