![Pyrrolo[2,3-d]pyrimidin-4-ol (CAS: 3680-71-5) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0650381.png "Pyrrolo[2,3-d]pyrimidin-4-ol chemical structure")
Pyrrolo[2,3-d]pyrimidin-4-ol
Catalog No: FT-0650381
CAS No: 3680-71-5
- Chemical Name: Pyrrolo[2,3-d]pyrimidin-4-ol
- Molecular Formula: C6H5N3O
- Molecular Weight: 135.12
- InChI Key: FBMZEITWVNHWJW-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5N3O/c10-6-4-1-2-7-5(4)8-3-9-6/h1-3H,(H2,7,8,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 135.123 |
| Density: | 1.6±0.1 g/cm3 |
| CAS: | 3680-71-5 |
| Bolling_Point: | 473.1±18.0 °C at 760 mmHg |
| Product_Name: | Pyrrolo[2,3-d]pyrimidin-4-ol |
| Melting_Point: | 345-348ºC |
| Flash_Point: | 239.9±21.2 °C |
| MF: | C6H5N3O |
| LogP: | -0.70 |
|---|---|
| Flash_Point: | 239.9±21.2 °C |
| Refractive_Index: | 1.784 |
| FW: | 135.123 |
| Bolling_Point: | 473.1±18.0 °C at 760 mmHg |
| Density: | 1.6±0.1 g/cm3 |
| Melting_Point: | 345-348ºC |
| PSA: | 61.54000 |
| Exact_Mass: | 135.043259 |
| Vapor_Pressure: | 0.0±1.2 mmHg at 25°C |
| MF: | C6H5N3O |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H317-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
