2-Chloro-5-fluoronicotinic acid
Catalog No: FT-0650045
CAS No: 38186-88-8
- Chemical Name: 2-Chloro-5-fluoronicotinic acid
- Molecular Formula: C6H3ClFNO2
- Molecular Weight: 175.54
- InChI Key: WMADTZFXZAITIR-UHFFFAOYSA-N
- InChI: InChI=1S/C6H3ClFNO2/c7-5-4(6(10)11)1-3(8)2-9-5/h1-2H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 175.545 |
| Density: | 1.6±0.1 g/cm3 |
| CAS: | 38186-88-8 |
| Bolling_Point: | 297.0±35.0 °C at 760 mmHg |
| Product_Name: | 2-Chloro-5-fluoronicotinic acid |
| Melting_Point: | 141-142ºC |
| Flash_Point: | 133.4±25.9 °C |
| MF: | C6H3ClFNO2 |
| Density: | 1.6±0.1 g/cm3 |
|---|---|
| LogP: | 0.58 |
| Flash_Point: | 133.4±25.9 °C |
| Melting_Point: | 141-142ºC |
| FW: | 175.545 |
| PSA: | 50.19000 |
| Exact_Mass: | 174.983627 |
| MF: | C6H3ClFNO2 |
| Bolling_Point: | 297.0±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Refractive_Index: | 1.563 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)