D-Allylglycine
Catalog No: FT-0649687
CAS No: 54594-06-8
- Chemical Name: D-Allylglycine
- Molecular Formula: C5H9NO2
- Molecular Weight: 115.13
- InChI Key: WNNNWFKQCKFSDK-SCSAIBSYSA-N
- InChI: InChI=1S/C5H9NO2/c1-2-3-4(6)5(7)8/h2,4H,1,3,6H2,(H,7,8)/t4-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| CAS: | 54594-06-8 |
| MF: | C5H9NO2 |
| Flash_Point: | 93.5±25.4 °C |
| Product_Name: | D-Allylglycine |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 115.131 |
| Bolling_Point: | 230.9±33.0 °C at 760 mmHg |
| Refractive_Index: | 1.484 |
|---|---|
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| MF: | C5H9NO2 |
| Flash_Point: | 93.5±25.4 °C |
| LogP: | 0.26 |
| FW: | 115.131 |
| Density: | 1.1±0.1 g/cm3 |
| PSA: | 49.33000 |
| Bolling_Point: | 230.9±33.0 °C at 760 mmHg |
| Exact_Mass: | 115.063332 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| HS_Code: | 2922499990 |
| Safety_Statements: | 22-24/25-36-26 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)