1-METHYL-3,5-DINITRO-1H-PYRIDIN-2-ONE
Catalog No: FT-0649251
CAS No: 14150-94-8
- Chemical Name: 1-METHYL-3,5-DINITRO-1H-PYRIDIN-2-ONE
- Molecular Formula: C6H5N3O5
- Molecular Weight: 199.12
- InChI Key: QARVELJVEBLWGK-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5N3O5/c1-7-3-4(8(11)12)2-5(6(7)10)9(13)14/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 199.121 |
| Density: | 1.6±0.1 g/cm3 |
| CAS: | 14150-94-8 |
| Bolling_Point: | 289.5±40.0 °C at 760 mmHg |
| Product_Name: | 1-Methyl-3,5-dinitro-2(1H)-pyridinone |
| Melting_Point: | N/A |
| Flash_Point: | 128.9±27.3 °C |
| MF: | C6H5N3O5 |
| Density: | 1.6±0.1 g/cm3 |
|---|---|
| LogP: | -1.21 |
| Flash_Point: | 128.9±27.3 °C |
| Refractive_Index: | 1.612 |
| FW: | 199.121 |
| PSA: | 113.64000 |
| MF: | C6H5N3O5 |
| Bolling_Point: | 289.5±40.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 199.022919 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Warning_Statement: | P301 + P312 + P330 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)