3-Bromo-2-fluoro-5-methylpyridine
Catalog No: FT-0648108
CAS No: 17282-01-8
- Chemical Name: 3-Bromo-2-fluoro-5-methylpyridine
- Molecular Formula: C6H5BrFN
- Molecular Weight: 190.01
- InChI Key: FWKQBHMQYXTOTD-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5BrFN/c1-4-2-5(7)6(8)9-3-4/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 190.013 |
| Density: | 1.6±0.1 g/cm3 |
| CAS: | 17282-01-8 |
| Bolling_Point: | 207.8±35.0 °C at 760 mmHg |
| Product_Name: | 3-Bromo-2-fluoro-5-methylpyridine |
| Melting_Point: | N/A |
| Flash_Point: | 79.5±25.9 °C |
| MF: | C6H5BrFN |
| Density: | 1.6±0.1 g/cm3 |
|---|---|
| LogP: | 2.24 |
| Flash_Point: | 79.5±25.9 °C |
| Refractive_Index: | 1.530 |
| FW: | 190.013 |
| PSA: | 12.89000 |
| MF: | C6H5BrFN |
| Bolling_Point: | 207.8±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.3±0.4 mmHg at 25°C |
| Exact_Mass: | 188.958939 |
| Hazard_Codes: | Xi |
|---|---|
| Risk_Statements(EU): | R20/21/22 |
| Safety_Statements: | 26-36 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)