5-Methylpyridin-3-amine
Catalog No: FT-0648087
CAS No: 3430-19-1
- Chemical Name: 5-Methylpyridin-3-amine
- Molecular Formula: C6H8N2
- Molecular Weight: 108.14
- InChI Key: JXUWZXFVCBODAN-UHFFFAOYSA-N
- InChI: InChI=1S/C6H8N2/c1-5-2-6(7)4-8-3-5/h2-4H,7H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 108.141 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 3430-19-1 |
| Bolling_Point: | 261.1±20.0 °C at 760 mmHg |
| Product_Name: | 3-Amino-5-methylpyridine |
| Melting_Point: | 59-63ºC |
| Flash_Point: | 135.6±9.0 °C |
| MF: | C6H8N2 |
| LogP: | 0.44 |
|---|---|
| Flash_Point: | 135.6±9.0 °C |
| Refractive_Index: | 1.574 |
| FW: | 108.141 |
| Bolling_Point: | 261.1±20.0 °C at 760 mmHg |
| Density: | 1.1±0.1 g/cm3 |
| Melting_Point: | 59-63ºC |
| PSA: | 38.91000 |
| Exact_Mass: | 108.068748 |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| MF: | C6H8N2 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn:Harmful; |
| Risk_Statements(EU): | R22;R37/38;R41 |
| Safety_Statements: | S26-S36/37/39 |
| Symbol: | Danger |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)