![3-BROMOIMIDAZO[1,2-A]PYRAZINE (CAS: 57948-41-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0648036.png "3-BROMOIMIDAZO[1,2-A]PYRAZINE chemical structure")
3-BROMOIMIDAZO[1,2-A]PYRAZINE
Catalog No: FT-0648036
CAS No: 57948-41-1
- Chemical Name: 3-BROMOIMIDAZO[1,2-A]PYRAZINE
- Molecular Formula: C6H4BrN3
- Molecular Weight: 198.02
- InChI Key: OZNGJOXLTIENCF-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4BrN3/c7-5-3-9-6-4-8-1-2-10(5)6/h1-4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-Bromoimidazo[1,2-a]pyrazine |
|---|---|
| Bolling_Point: | N/A |
| MF: | C6H4BrN3 |
| Symbol: | GHS05, GHS07 |
| Melting_Point: | 191-196ºC |
| CAS: | 57948-41-1 |
| Density: | 1.9±0.1 g/cm3 |
| FW: | 198.020 |
| Flash_Point: | N/A |
| Exact_Mass: | 196.958847 |
|---|---|
| MF: | C6H4BrN3 |
| Refractive_Index: | 1.751 |
| Density: | 1.9±0.1 g/cm3 |
| PSA: | 30.19000 |
| FW: | 198.020 |
| LogP: | 0.80 |
| Melting_Point: | 191-196ºC |
| Risk_Statements(EU): | R22 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Safety_Statements: | H302-H315-H318-H335 |
| HS_Code: | 2933990090 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS05, GHS07 |
| Hazard_Codes: | Xn |
