6-FLUORO-2(3H)-BENZOTHIAZOLONE
Catalog No: FT-0647648
CAS No: 63754-96-1
- Chemical Name: 6-FLUORO-2(3H)-BENZOTHIAZOLONE
- Molecular Formula: C7H4FNOS
- Molecular Weight: 169.18
- InChI Key: HCFZOCSVSDAYQF-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4FNOS/c8-4-1-2-5-6(3-4)11-7(10)9-5/h1-3H,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Flash_Point: | N/A |
|---|---|
| FW: | 169.17600 |
| Bolling_Point: | N/A |
| Product_Name: | 6-Fluoro-2(3H)-Benzothiazolone |
| CAS: | 63754-96-1 |
| MF: | C7H4FNOS |
| Melting_Point: | N/A |
| Density: | 1.474 g/cm3 |
| Refractive_Index: | 1.63 |
|---|---|
| PSA: | 61.10000 |
| FW: | 169.17600 |
| LogP: | 1.72870 |
| Exact_Mass: | 169.00000 |
| MF: | C7H4FNOS |
| Density: | 1.474 g/cm3 |
| HS_Code: | 2934999090 |
|---|