4-Chloro-5-iodo-7H-pyrrol[2,3-d]pyrimidine
Catalog No: FT-0646880
CAS No: 123148-78-7
- Chemical Name: 4-Chloro-5-iodo-7H-pyrrol[2,3-d]pyrimidine
- Molecular Formula: C6H3ClIN3
- Molecular Weight: 279.46
- InChI Key: CBWBJFJMNBPWAL-UHFFFAOYSA-N
- InChI: InChI=1S/C6H3ClIN3/c7-5-4-3(8)1-9-6(4)11-2-10-5/h1-2H,(H,9,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 279.466 |
| Density: | 2.3±0.1 g/cm3 |
| CAS: | 123148-78-7 |
| Bolling_Point: | N/A |
| Product_Name: | 4-Chloro-5-iodo-7H-pyrrolo[2,3-d]pyrimidine |
| Melting_Point: | 179-183ºC |
| Flash_Point: | N/A |
| MF: | C6H3ClIN3 |
| Melting_Point: | 179-183ºC |
|---|---|
| Density: | 2.3±0.1 g/cm3 |
| LogP: | 2.06 |
| Refractive_Index: | 1.804 |
| FW: | 279.466 |
| PSA: | 41.57000 |
| MF: | C6H3ClIN3 |
| Exact_Mass: | 278.906006 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22;R36/37/38 |
| Safety_Statements: | 26-36/37 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)