3-Acetyl-2-bromopyridine
Catalog No: FT-0646591
CAS No: 84199-61-1
- Chemical Name: 3-Acetyl-2-bromopyridine
- Molecular Formula: C7H6BrNO
- Molecular Weight: 200.03
- InChI Key: VYJZSPNXTDPUJW-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6BrNO/c1-5(10)6-3-2-4-9-7(6)8/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 200.033 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 84199-61-1 |
| Bolling_Point: | 292.2±25.0 °C at 760 mmHg |
| Product_Name: | 3-Acetyl-2-bromopyridine |
| Melting_Point: | N/A |
| Flash_Point: | 130.5±23.2 °C |
| MF: | C7H6BrNO |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 1.11 |
| Flash_Point: | 130.5±23.2 °C |
| Refractive_Index: | 1.558 |
| FW: | 200.033 |
| PSA: | 29.96000 |
| MF: | C7H6BrNO |
| Bolling_Point: | 292.2±25.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 198.963272 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)