![7-bromo-4-chloropyrido[3,2-d]pyrimidine (CAS: 573675-31-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0646346.png "7-bromo-4-chloropyrido[3,2-d]pyrimidine chemical structure")
7-bromo-4-chloropyrido[3,2-d]pyrimidine
Catalog No: FT-0646346
CAS No: 573675-31-7
- Chemical Name: 7-bromo-4-chloropyrido[3,2-d]pyrimidine
- Molecular Formula: C7H3BrClN3
- Molecular Weight: 244.47
- InChI Key: POZFSLLRNAMHBC-UHFFFAOYSA-N
- InChI: InChI=1S/C7H3BrClN3/c8-4-1-5-6(10-2-4)7(9)12-3-11-5/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 244.47600 |
| Density: | 1.861 g/cm3 |
| CAS: | 573675-31-7 |
| Bolling_Point: | 334ºC at 760 mmHg |
| Product_Name: | 7-Bromo-4-chloropyrido[3,2-d]pyrimidine |
| Melting_Point: | N/A |
| Flash_Point: | 155.8ºC |
| MF: | C7H3BrClN3 |
| Density: | 1.861 g/cm3 |
|---|---|
| LogP: | 2.44070 |
| Flash_Point: | 155.8ºC |
| Refractive_Index: | 1.703 |
| FW: | 244.47600 |
| PSA: | 38.67000 |
| MF: | C7H3BrClN3 |
| Bolling_Point: | 334ºC at 760 mmHg |
| Exact_Mass: | 242.92000 |
| Warning_Statement: | P301 + P310 |
|---|---|
| Safety_Statements: | H301 |
| Symbol: | Danger |
| RIDADR: | UN 2811 6.1 / PGIII |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)