6-Iodoquinoline
Catalog No: FT-0645784
CAS No: 13327-31-6
- Chemical Name: 6-Iodoquinoline
- Molecular Formula: C9H6IN
- Molecular Weight: 255.05
- InChI Key: WKTASELJZCIVBR-UHFFFAOYSA-N
- InChI: InChI=1S/C9H6IN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h1-6H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 255.055 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 13327-31-6 |
| Bolling_Point: | 320.7±15.0 °C at 760 mmHg |
| Product_Name: | 6-Iodchinolin |
| Melting_Point: | N/A |
| Flash_Point: | 147.8±20.4 °C |
| MF: | C9H6IN |
| Density: | 1.8±0.1 g/cm3 |
|---|---|
| LogP: | 3.14 |
| Flash_Point: | 147.8±20.4 °C |
| Refractive_Index: | 1.724 |
| FW: | 255.055 |
| PSA: | 12.89000 |
| MF: | C9H6IN |
| Bolling_Point: | 320.7±15.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 254.954483 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)