2-Acetamidophenylboronic acid
Catalog No: FT-0643625
CAS No: 169760-16-1
- Chemical Name: 2-Acetamidophenylboronic acid
- Molecular Formula: C8H10BNO3
- Molecular Weight: 178.98
- InChI Key: UMOPBIVXPOETPG-UHFFFAOYSA-N
- InChI: InChI=1S/C8H10BNO3/c1-6(11)10-8-5-3-2-4-7(8)9(12)13/h2-5,12-13H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 178.981 |
|---|---|
| CAS: | 169760-16-1 |
| Melting_Point: | 300ºC |
| Bolling_Point: | N/A |
| MF: | C8H10BNO3 |
| Product_Name: | (2-Acetamidophenyl)boronic acid |
| Flash_Point: | N/A |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 178.981 |
|---|---|
| MF: | C8H10BNO3 |
| Exact_Mass: | 179.075378 |
| Refractive_Index: | 1.553 |
| PSA: | 69.56000 |
| LogP: | 0.45 |
| Melting_Point: | 300ºC |
| Density: | 1.2±0.1 g/cm3 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2931900090 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)