(S)-(-)-N-(1-PHENYLETHYL)PHTHALAMIC ACID
Catalog No: FT-0638148
CAS No: 21752-36-3
- Chemical Name: (S)-(-)-N-(1-PHENYLETHYL)PHTHALAMIC ACID
- Molecular Formula: C16H15NO3
- Molecular Weight: 269.29
- InChI Key: VCFKXWGKKDZMPO-NSHDSACASA-N
- InChI: InChI=1S/C16H15NO3/c1-11(12-7-3-2-4-8-12)17-15(18)13-9-5-6-10-14(13)16(19)20/h2-11H,1H3,(H,17,18)(H,19,20)/t11-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 21752-36-3 |
| Flash_Point: | 256.3ºC |
| Product_Name: | (s)-(-)-n-(1-phenylethyl)phthalamic acid |
| Bolling_Point: | 500.3ºC at 760 mmHg |
| FW: | 269.29500 |
| Melting_Point: | 128-130 °C |
| MF: | C16H15NO3 |
| Density: | 1.222 g/cm3 |
| Refractive_Index: | -46 ° (C=2, EtOH) |
|---|---|
| Vapor_Pressure: | 7.92E-11mmHg at 25°C |
| Flash_Point: | 256.3ºC |
| LogP: | 3.26670 |
| Bolling_Point: | 500.3ºC at 760 mmHg |
| PSA: | 66.40000 |
| Molecular_Structure: | ['1 . Molar refractive index 7592 ', '2 . Molar volume (m3/mol)2202 ', '3 . Parachor (902K)5931 ', '4 表面张力(dyne/cm)525 ', '5 . Polarizability (10-24cm3)3010'] |
| Computational_Chemistry: | ['1. XlogP :26 ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :4 ', '5. Isotope Atom Count :2 ', '6. TPSA 664 ', '7. Heavy Atom Count :20 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :350 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :1 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 128-130 °C |
| MF: | C16H15NO3 |
| Exact_Mass: | 269.10500 |
| FW: | 269.29500 |
| Density: | 1.222 g/cm3 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）Unknow ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）128-130 ', '5. Boiling point（ºC,Atmospheric pressure）Unknow ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive index-46 ° (C=2, EtOH) ', '8. Flash point（ºC）Unknow ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2924299090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
