2-Amino-5-methoxybenzoic acid
Catalog No: FT-0636243
CAS No: 6705-03-9
- Chemical Name: 2-Amino-5-methoxybenzoic acid
- Molecular Formula: C8H9NO3
- Molecular Weight: 167.16
- InChI Key: UMKSAURFQFUULT-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9NO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,9H2,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 6705-03-9 |
| Flash_Point: | 165.4±23.7 °C |
| Product_Name: | 2-Amino-5-methoxybenzoic acid |
| Bolling_Point: | 349.9±27.0 °C at 760 mmHg |
| FW: | 167.162 |
| Melting_Point: | 148-152°C |
| MF: | C8H9NO3 |
| Density: | 1.3±0.1 g/cm3 |
| Refractive_Index: | 1.604 |
|---|---|
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 165.4±23.7 °C |
| LogP: | 1.23 |
| Bolling_Point: | 349.9±27.0 °C at 760 mmHg |
| FW: | 167.162 |
| PSA: | 72.55000 |
| Melting_Point: | 148-152°C |
| MF: | C8H9NO3 |
| Exact_Mass: | 167.058243 |
| Molecular_Structure: | ['1. Molar refractive index 4409 ', '2. Molar volume 1282 ', '3. Parachor (902K)3519 ', '4. Surface tension 566 ', '5. Dielectric constant N/A ', '6. Polarizability 1748 ', '7. Single isotope mass 167058243 Da ', '8. Nominal mass 167 Da ', '9. Average mass 167162 Da'] |
| Density: | 1.3±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R22 |
| HS_Code: | 2942000000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful; |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)