3-Chloro-4-hydroxyaniline
Catalog No: FT-0635077
CAS No: 3964-52-1
- Chemical Name: 3-Chloro-4-hydroxyaniline
- Molecular Formula: C6H6ClNO
- Molecular Weight: 143.57
- InChI Key: ZYZQSCWSPFLAFM-UHFFFAOYSA-N
- InChI: InChI=1S/C6H6ClNO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H,8H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 3964-52-1 |
| Flash_Point: | 121.2±23.2 °C |
| Product_Name: | 2-Amino-4-chlorophenol |
| Bolling_Point: | 276.8±25.0 °C at 760 mmHg |
| FW: | 143.571 |
| Melting_Point: | 150-153 °C(lit.) |
| MF: | C6H6ClNO |
| Density: | 1.4±0.1 g/cm3 |
| Refractive_Index: | 1.651 |
|---|---|
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Flash_Point: | 121.2±23.2 °C |
| LogP: | 1.67 |
| Bolling_Point: | 276.8±25.0 °C at 760 mmHg |
| FW: | 143.571 |
| PSA: | 46.25000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :7 ', '6. TPSA 462 ', '7. Heavy Atom Count :9 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :991 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 150-153 °C(lit.) |
| MF: | C6H6ClNO |
| Exact_Mass: | 143.013794 |
| Density: | 1.4±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R20/21/22;R36/37/38 |
| HS_Code: | 2922299090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful; |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H312-H315-H319-H332-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)