6-Methoxyharmalan
Catalog No: FT-0634918
CAS No: 3589-73-9
- Chemical Name: 6-Methoxyharmalan
- Molecular Formula: C13H14N2O
- Molecular Weight: 214.26
- InChI Key: HMBHRMFLDKKSCT-UHFFFAOYSA-N
- InChI: InChI=1S/C13H14N2O/c1-8-13-10(5-6-14-8)11-7-9(16-2)3-4-12(11)15-13/h3-4,7,15H,5-6H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 214.26300 |
|---|---|
| CAS: | 3589-73-9 |
| Melting_Point: | 208 - 209ºC |
| Bolling_Point: | 417.7ºC at 760mmHg |
| MF: | C13H14N2O |
| Product_Name: | 6-methoxy-1-methyl-3,4-dihydro-2H-pyrido[3,4-b]indole |
| Flash_Point: | 206.4ºC |
| Density: | 1.25g/cm3 |
| FW: | 214.26300 |
|---|---|
| MF: | C13H14N2O |
| Exact_Mass: | 214.11100 |
| Flash_Point: | 206.4ºC |
| LogP: | 1.97720 |
| PSA: | 37.38000 |
| Refractive_Index: | 1.647 |
| Bolling_Point: | 417.7ºC at 760mmHg |
| Melting_Point: | 208 - 209ºC |
| Density: | 1.25g/cm3 |
| RTECS: | UU9802000 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| WGK_Germany: | 3 |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)