2-Chloro-6-nitrobenzothiazole
Catalog No: FT-0634252
CAS No: 2407-11-6
- Chemical Name: 2-Chloro-6-nitrobenzothiazole
- Molecular Formula: C7H3ClN2O2S
- Molecular Weight: 214.63
- InChI Key: KUCSJGBXJBQHNI-UHFFFAOYSA-N
- InChI: InChI=1S/C7H3ClN2O2S/c8-7-9-5-2-1-4(10(11)12)3-6(5)13-7/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 2407-11-6 |
| Flash_Point: | 211.8±5.3 °C |
| Product_Name: | 2-chloro-6-nitrobenzo[d]thiazole |
| Bolling_Point: | 336.7±15.0 °C at 760 mmHg |
| FW: | 174.196 |
| Melting_Point: | 192-195ºC |
| MF: | C11H10O2 |
| Density: | 1.2±0.1 g/cm3 |
| Refractive_Index: | 1.641 |
|---|---|
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 211.8±5.3 °C |
| LogP: | 2.63 |
| Bolling_Point: | 336.7±15.0 °C at 760 mmHg |
| FW: | 174.196 |
| PSA: | 86.95000 |
| Melting_Point: | 192-195ºC |
| MF: | C11H10O2 |
| Exact_Mass: | 174.068085 |
| Density: | 1.2±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)