Estrone 3-methyl ether
Catalog No: FT-0633716
CAS No: 1624-62-0
- Chemical Name: Estrone 3-methyl ether
- Molecular Formula: C19H24O2
- Molecular Weight: 284.4
- InChI Key: BCWWDWHFBMPLFQ-VXNCWWDNSA-N
- InChI: InChI=1S/C19H24O2/c1-19-10-9-15-14-6-4-13(21-2)11-12(14)3-5-16(15)17(19)7-8-18(19)20/h4,6,11,15-17H,3,5,7-10H2,1-2H3/t15-,16-,17+,19+/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS08 |
|---|---|
| CAS: | 1624-62-0 |
| Flash_Point: | 183.6±22.3 °C |
| Product_Name: | Estrone 3-methyl ether |
| Bolling_Point: | 427.4±45.0 °C at 760 mmHg |
| FW: | 284.393 |
| Melting_Point: | 167.5-169.5ºC |
| MF: | C19H24O2 |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.556 |
|---|---|
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Flash_Point: | 183.6±22.3 °C |
| LogP: | 4.34 |
| Bolling_Point: | 427.4±45.0 °C at 760 mmHg |
| FW: | 284.393 |
| PSA: | 26.30000 |
| Melting_Point: | 167.5-169.5ºC |
| MF: | C19H24O2 |
| Exact_Mass: | 284.177643 |
| Density: | 1.1±0.1 g/cm3 |
| Symbol: | GHS07, GHS08 |
|---|---|
| Risk_Statements(EU): | R20/21/22;R40 |
| HS_Code: | 2914509090 |
| Personal_Protective_Equipment: | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn:Harmful; |
| Warning_Statement: | P280 |
| Safety_Statements: | H302-H312-H332-H351 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)