MTH-DL-TYROSINE
Catalog No: FT-0633081
CAS No: 886-26-0
- Chemical Name: MTH-DL-TYROSINE
- Molecular Formula: C11H12N2O2S
- Molecular Weight: 236.29
- InChI Key: VYIBESPZQFAJRM-UHFFFAOYSA-N
- InChI: InChI=1S/C11H12N2O2S/c1-13-10(15)9(12-11(13)16)6-7-2-4-8(14)5-3-7/h2-5,9,14H,6H2,1H3,(H,12,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 5-[(4-hydroxyphenyl)methyl]-3-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| Flash_Point: | 186.6ºC |
| Melting_Point: | N/A |
| FW: | 236.29000 |
| Density: | 1.4g/cm3 |
| CAS: | 886-26-0 |
| Bolling_Point: | 384.9ºC at 760 mmHg |
| MF: | C11H12N2O2S |
| Density: | 1.4g/cm3 |
|---|---|
| LogP: | 0.91650 |
| Flash_Point: | 186.6ºC |
| Refractive_Index: | 1.689 |
| FW: | 236.29000 |
| PSA: | 84.66000 |
| MF: | C11H12N2O2S |
| Bolling_Point: | 384.9ºC at 760 mmHg |
| Exact_Mass: | 236.06200 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2933990090 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)