(+/-)-5-ETHYL-5-PHENYLHYDANTOIN
Catalog No: FT-0632677
CAS No: 631-07-2
- Chemical Name: (+/-)-5-ETHYL-5-PHENYLHYDANTOIN
- Molecular Formula: C11H12N2O2
- Molecular Weight: 204.22
- InChI Key: UDTWZFJEMMUFLC-UHFFFAOYSA-N
- InChI: InChI=1S/C11H12N2O2/c1-2-11(8-6-4-3-5-7-8)9(14)12-10(15)13-11/h3-7H,2H2,1H3,(H2,12,13,14,15)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 631-07-2 |
| Flash_Point: | N/A |
| Product_Name: | rac N-Desmethyl Mephenytoin |
| Bolling_Point: | N/A |
| FW: | 204.22500 |
| Melting_Point: | 195-200ºC |
| MF: | C11H12N2O2 |
| Density: | 1.173 g/cm3 |
| Melting_Point: | 195-200ºC |
|---|---|
| Refractive_Index: | 1.538 |
| MF: | C11H12N2O2 |
| Exact_Mass: | 204.09000 |
| LogP: | 1.78890 |
| FW: | 204.22500 |
| Density: | 1.173 g/cm3 |
| PSA: | 58.20000 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R22 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RTECS: | MU2452000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)