2,3-DINITROPHENOL
Catalog No: FT-0631292
CAS No: 66-56-8
- Chemical Name: 2,3-DINITROPHENOL
- Molecular Formula: C6H4N2O5
- Molecular Weight: 184.11
- InChI Key: MHKBMNACOMRIAW-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4N2O5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS06, GHS08, GHS09 |
|---|---|
| CAS: | 66-56-8 |
| Flash_Point: | 151.2ºC |
| Product_Name: | 2,3-dinitrophenol |
| Bolling_Point: | 328.9ºC at 760 mmHg |
| FW: | 184.10600 |
| Melting_Point: | 143-146ºC |
| MF: | C6H4N2O5 |
| Density: | 1.65 g/cm3 |
| Melting_Point: | 143-146ºC |
|---|---|
| MF: | C6H4N2O5 |
| Flash_Point: | 151.2ºC |
| LogP: | 2.25500 |
| FW: | 184.10600 |
| Density: | 1.65 g/cm3 |
| PSA: | 111.87000 |
| Bolling_Point: | 328.9ºC at 760 mmHg |
| Exact_Mass: | 184.01200 |
| Hazard_Class: | 4.1 |
|---|---|
| Symbol: | GHS06, GHS08, GHS09 |
| Risk_Statements(EU): | R23/24/25 |
| HS_Code: | 2908999090 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| RTECS: | SL2700000 |
| RIDADR: | UN 1320 |
| Hazard_Codes: | T: Toxic;N: Dangerous for the environment; |
| Warning_Statement: | P261-P273-P280-P301 + P310-P311 |
| Safety_Statements: | H301-H311-H331-H373-H411 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)