ZOLMITRIPTANE
Catalog No: FT-0631159
CAS No: 139264-17-8
- Chemical Name: ZOLMITRIPTANE
- Molecular Formula: C16H21N3O2
- Molecular Weight: 287.36
- InChI Key: ULSDMUVEXKOYBU-CYBMUJFWSA-N
- InChI: InChI=1S/C16H21N3O2/c1-19(2)6-5-12-9-17-15-4-3-11(8-14(12)15)7-13-10-21-16(20)18-13/h3-4,8-9,13,17H,5-7,10H2,1-2H3,(H,18,20)/t13-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 136-141ºC |
|---|---|
| CAS: | 139264-17-8 |
| MF: | C16H21N3O2 |
| Flash_Point: | 294.5±26.8 °C |
| Product_Name: | Zolmitriptan |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 287.357 |
| Bolling_Point: | 563.3±38.0 °C at 760 mmHg |
| Melting_Point: | 136-141ºC |
|---|---|
| Refractive_Index: | 1.620 |
| Vapor_Pressure: | 0.0±1.5 mmHg at 25°C |
| MF: | C16H21N3O2 |
| Flash_Point: | 294.5±26.8 °C |
| LogP: | 1.64 |
| FW: | 287.357 |
| Density: | 1.2±0.1 g/cm3 |
| PSA: | 57.36000 |
| Bolling_Point: | 563.3±38.0 °C at 760 mmHg |
| Exact_Mass: | 287.163391 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| RTECS: | RQ2707000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2934999090 |
| Safety_Statements: | S26-S36 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)