Adapalene
Catalog No: FT-0631040
CAS No: 106685-40-9
- Chemical Name: Adapalene
- Molecular Formula: C28H28O3
- Molecular Weight: 412.5
- InChI Key: LZCDAPDGXCYOEH-UHFFFAOYSA-N
- InChI: InChI=1S/C28H28O3/c1-31-26-7-6-23(21-2-3-22-12-24(27(29)30)5-4-20(22)11-21)13-25(26)28-14-17-8-18(15-28)10-19(9-17)16-28/h2-7,11-13,17-19H,8-10,14-16H2,1H3,(H,29,30)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Adapalene |
|---|---|
| Bolling_Point: | 606.3±55.0 °C at 760 mmHg |
| Density: | 1.2±0.1 g/cm3 |
| MF: | C28H28O3 |
| CAS: | 106685-40-9 |
| Melting_Point: | 319-322ºC |
| Flash_Point: | 205.9±25.0 °C |
| FW: | 412.520 |
| MF: | C28H28O3 |
|---|---|
| Bolling_Point: | 606.3±55.0 °C at 760 mmHg |
| Exact_Mass: | 412.203857 |
| Melting_Point: | 319-322ºC |
| Refractive_Index: | 1.655 |
| PSA: | 46.53000 |
| Flash_Point: | 205.9±25.0 °C |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 412.520 |
| LogP: | 8.04 |
| Vapor_Pressure: | 0.0±1.8 mmHg at 25°C |
| Safety_Statements: | H413 |
|---|---|
| HS_Code: | 2918990090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)