Tobramycin
Catalog No: FT-0630567
CAS No: 32986-56-4
- Chemical Name: Tobramycin
- Molecular Formula: C18H37N5O9
- Molecular Weight: 467.5
- InChI Key: NLVFBUXFDBBNBW-PBSUHMDJSA-N
- InChI: InChI=1S/C18H37N5O9/c19-3-9-8(25)2-7(22)17(29-9)31-15-5(20)1-6(21)16(14(15)28)32-18-13(27)11(23)12(26)10(4-24)30-18/h5-18,24-28H,1-4,19-23H2/t5-,6+,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 178ºC |
|---|---|
| CAS: | 32986-56-4 |
| MF: | C18H37N5O9 |
| Flash_Point: | 422.8±32.9 °C |
| Product_Name: | Tobramycin |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 467.514 |
| Bolling_Point: | 775.4±60.0 °C at 760 mmHg |
| Refractive_Index: | 1.651 |
|---|---|
| Vapor_Pressure: | 0.0±6.0 mmHg at 25°C |
| Flash_Point: | 422.8±32.9 °C |
| LogP: | -3.41 |
| Bolling_Point: | 775.4±60.0 °C at 760 mmHg |
| FW: | 467.514 |
| PSA: | 268.17000 |
| Melting_Point: | 178ºC |
| MF: | C18H37N5O9 |
| Exact_Mass: | 467.259125 |
| Density: | 1.5±0.1 g/cm3 |
| Hazard_Class: | 6.1 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| WGK_Germany: | 2 |
| RTECS: | WK2100000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Safety_Statements: | S26-S37/39 |
| Packing_Group: | II |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)