MINAPRINE DIHYDROCHLORIDE
Catalog No: FT-0630519
CAS No: 25905-77-5
- Molecular Formula: 298.4
- Formula Weight: C17H22N4O
- Inchl Key: LDMWSLGGVTVJPG-UHFFFAOYSA-N
- Inchl: InChI=1S/C17H22N4O/c1-14-13-16(15-5-3-2-4-6-15)19-20-17(14)18-7-8-21-9-11-22-12-10-21/h2-6,13H,7-12H2,1H3,(H,18,20)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 371.30500 |
| Density: | 1.156g/cm3 |
| CAS: | 25905-77-5 |
| Bolling_Point: | 531.2ºC at 760 mmHg |
| Product_Name: | Minaprine |
| Melting_Point: | N/A |
| Flash_Point: | 275.1ºC |
| MF: | C17H24Cl2N4O |
| Density: | 1.156g/cm3 |
|---|---|
| LogP: | 3.81100 |
| Flash_Point: | 275.1ºC |
| Refractive_Index: | 1.595 |
| FW: | 371.30500 |
| PSA: | 50.28000 |
| MF: | C17H24Cl2N4O |
| Bolling_Point: | 531.2ºC at 760 mmHg |
| Vapor_Pressure: | 2.29E-11mmHg at 25°C |
| Exact_Mass: | 370.13300 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | QE3477830 |
| Hazard_Codes: | Xn |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)