Diflunisal
Catalog No: FT-0630487
CAS No: 22494-42-4
- Chemical Name: Diflunisal
- Molecular Formula: C13H8F2O3
- Molecular Weight: 250.2
- InChI Key: HUPFGZXOMWLGNK-UHFFFAOYSA-N
- InChI: InChI=1S/C13H8F2O3/c14-8-2-3-9(11(15)6-8)7-1-4-12(16)10(5-7)13(17)18/h1-6,16H,(H,17,18)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS08 |
|---|---|
| CAS: | 22494-42-4 |
| Flash_Point: | 187.8±27.9 °C |
| Product_Name: | Diflunisal |
| Bolling_Point: | 386.9±42.0 °C at 760 mmHg |
| FW: | 250.198 |
| Melting_Point: | 32-36 °C |
| MF: | C13H8F2O3 |
| Density: | 1.4±0.1 g/cm3 |
| Refractive_Index: | 1.601 |
|---|---|
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Flash_Point: | 187.8±27.9 °C |
| LogP: | 4.44 |
| Bolling_Point: | 386.9±42.0 °C at 760 mmHg |
| FW: | 250.198 |
| PSA: | 57.53000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :5 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :4 ', '6. TPSA 575 ', '7. Heavy Atom Count :18 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :311 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 32-36 °C |
| MF: | C13H8F2O3 |
| Exact_Mass: | 250.044144 |
| Density: | 1.4±0.1 g/cm3 |
| Symbol: | GHS07, GHS08 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2918290000 |
| Risk_Statements(EU): | R22;R36/37/38;R63 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RTECS: | DV2030000 |
| Hazard_Codes: | Xn:Harmful; |
| Warning_Statement: | P280-P301 + P312 + P330-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335-H361 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)