Enalapril maleate
Catalog No: FT-0625659
CAS No: 76095-16-4
- Chemical Name: Enalapril maleate
- Molecular Formula: C24H32N2O9
- Molecular Weight: 492.5
- InChI Key: OYFJQPXVCSSHAI-QFPUQLAESA-N
- InChI: InChI=1S/C20H28N2O5.C4H4O4/c1-3-27-20(26)16(12-11-15-8-5-4-6-9-15)21-14(2)18(23)22-13-7-10-17(22)19(24)25;5-3(6)1-2-4(7)8/h4-6,8-9,14,16-17,21H,3,7,10-13H2,1-2H3,(H,24,25);1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,16-,17-;/m0./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Enalapril maleate |
|---|---|
| Bolling_Point: | 0ºC |
| MF: | C24H32N2O9 |
| Symbol: | GHS08 |
| Melting_Point: | 143-144.5ºC |
| CAS: | 76095-16-4 |
| Density: | N/A |
| FW: | 492.519 |
| Flash_Point: | N/A |
| Exact_Mass: | 492.210785 |
|---|---|
| MF: | C24H32N2O9 |
| Bolling_Point: | 0ºC |
| FW: | 492.519 |
| Melting_Point: | 143-144.5ºC |
| LogP: | 1.64520 |
| PSA: | 170.54000 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard_Codes: | Xi |
| RTECS: | TW3666000 |
| HS_Code: | 2933990090 |
| Safety_Statements: | 22-24/25-36/37-26 |
| Warning_Statement: | P281 |
| Symbol: | GHS08 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)